About 2-(2-fluoroethoxy)ethyl 4-methylbenzenesulfonate
2-(2-fluoroethoxy)ethyl 4-methylbenzenesulfonate (PubChem CID 59557777) has the molecular formula C11H15FO4S
and a molecular weight of 262.30 g/mol. Its IUPAC name is 2-(2-fluoroethoxy)ethyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 2-(2-fluoroethoxy)ethyl 4-methylbenzenesulfonate |
| PubChem CID | 59557777 |
| Molecular Formula | C11H15FO4S |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 2-(2-fluoroethoxy)ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCF)cc1 |
| InChI | InChI=1S/C11H15FO4S/c1-10-2-4-11(5-3-10)17(13,14)16-9-8-15-7-6-12/h2-5H,6-9H2,1H3 |
| InChIKey | VQTKDNCYXCDOSB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-fluoroethoxy)ethyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluoroethoxy)ethyl 4-methylbenzenesulfonate?
The IUPAC name of 2-(2-fluoroethoxy)ethyl 4-methylbenzenesulfonate (CID 59557777) is 2-(2-fluoroethoxy)ethyl 4-methylbenzenesulfonate.
What is the SMILES notation for 2-(2-fluoroethoxy)ethyl 4-methylbenzenesulfonate?
The canonical SMILES for 2-(2-fluoroethoxy)ethyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCCOCCF)cc1.
What is the InChIKey of 2-(2-fluoroethoxy)ethyl 4-methylbenzenesulfonate?
The InChIKey is VQTKDNCYXCDOSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15FO4S/c1-10-2-4-11(5-3-10)17(13,14)16-9-8-15-7-6-12/h2-5H,6-9H2,1H3.
What are the key properties of 2-(2-fluoroethoxy)ethyl 4-methylbenzenesulfonate?
2-(2-fluoroethoxy)ethyl 4-methylbenzenesulfonate has a molecular weight of 262.30 g/mol, XLogP of 1.69, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluoroethoxy)ethyl 4-methylbenzenesulfonate is sourced from PubChem (CID 59557777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).