C29H38FN3O3 — CID 59558154
N-[4-[(3aR,6aR)-5-(oxolan-3-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-fluorophenyl]-4-butoxy-N-methylbenzamide (PubChem CID 59558154) has the molecular formula C29H38FN3O3 and a molecular weight of 495.64 g/mol. Its IUPAC name is N-[4-[(3aR,6aR)-5-(oxolan-3-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-fluorophenyl]-4-butoxy-N-methylbenzamide.
| Compound Name | N-[4-[(3aR,6aR)-5-(oxolan-3-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-fluorophenyl]-4-butoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 59558154 |
| Molecular Formula | C29H38FN3O3 |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | N-[4-[(3aR,6aR)-5-(oxolan-3-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-fluorophenyl]-4-butoxy-N-methylbenzamide |
| SMILES | CCCCOc1ccc(C(=O)N(C)c2ccc(N3CC[C@@H]4CN(CC5CCOC5)C[C@@H]43)c(F)c2)cc1 |
| InChI | InChI=1S/C29H38FN3O3/c1-3-4-14-36-25-8-5-22(6-9-25)29(34)31(2)24-7-10-27(26(30)16-24)33-13-11-23-18-32(19-28(23)33)17-21-12-15-35-20-21/h5-10,16,21,23,28H,3-4,11-15,17-20H2,1-2H3/t21?,23-,28+/m1/s1 |
| InChIKey | UERNEPWLTKVMGE-NNCGZRGQSA-N |
| XLogP | 4.83 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|