C24H24N4O4P2S2+2 — CID 59558285
(4-formylphenoxy)-[[(E)-[4-[[[(E)-(4-methoxyphenyl)methylideneamino]-methylamino]-sulfanylidenephosphaniumyl]oxyphenyl]methylideneamino]-methylamino]-sulfanylidenephosphanium (PubChem CID 59558285) has the molecular formula C24H24N4O4P2S2+2 and a molecular weight of 558.56 g/mol. Its IUPAC name is (4-formylphenoxy)-[[(E)-[4-[[[(E)-(4-methoxyphenyl)methylideneamino]-methylamino]-sulfanylidenephosphaniumyl]oxyphenyl]methylideneamino]-methylamino]-sulfanylidenephosphanium.
| Compound Name | (4-formylphenoxy)-[[(E)-[4-[[[(E)-(4-methoxyphenyl)methylideneamino]-methylamino]-sulfanylidenephosphaniumyl]oxyphenyl]methylideneamino]-methylamino]-sulfanylidenephosphanium |
|---|---|
| PubChem CID | 59558285 |
| Molecular Formula | C24H24N4O4P2S2+2 |
| Molecular Weight | 558.56 g/mol |
| Exact Mass | 558.07 |
| IUPAC Name | (4-formylphenoxy)-[[(E)-[4-[[[(E)-(4-methoxyphenyl)methylideneamino]-methylamino]-sulfanylidenephosphaniumyl]oxyphenyl]methylideneamino]-methylamino]-sulfanylidenephosphanium |
| SMILES | COc1ccc(/C=N/N(C)[P+](=S)Oc2ccc(/C=N/N(C)[P+](=S)Oc3ccc(C=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H24N4O4P2S2/c1-27(25-16-19-4-10-22(30-3)11-5-19)33(35)31-23-12-6-20(7-13-23)17-26-28(2)34(36)32-24-14-8-21(18-29)9-15-24/h4-18H,1-3H3/q+2/b25-16+,26-17+ |
| InChIKey | LVDGEKNMBHVYFZ-ZZZAPRPPSA-N |
| XLogP | 5.74 |
| TPSA | 75.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.56 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|