About bicyclo[3.2.0]heptane-2,4-dione
bicyclo[3.2.0]heptane-2,4-dione (PubChem CID 59558535) has the molecular formula C7H8O2
and a molecular weight of 124.14 g/mol. Its IUPAC name is bicyclo[3.2.0]heptane-2,4-dione.
Molecular Properties
| Compound Name | bicyclo[3.2.0]heptane-2,4-dione |
| PubChem CID | 59558535 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | bicyclo[3.2.0]heptane-2,4-dione |
| SMILES | O=C1CC(=O)C2CCC12 |
| InChI | InChI=1S/C7H8O2/c8-6-3-7(9)5-2-1-4(5)6/h4-5H,1-3H2 |
| InChIKey | RUSUJAKXQJRXRZ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[3.2.0]heptane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.2.0]heptane-2,4-dione?
The IUPAC name of bicyclo[3.2.0]heptane-2,4-dione (CID 59558535) is bicyclo[3.2.0]heptane-2,4-dione.
What is the SMILES notation for bicyclo[3.2.0]heptane-2,4-dione?
The canonical SMILES for bicyclo[3.2.0]heptane-2,4-dione is O=C1CC(=O)C2CCC12.
What is the InChIKey of bicyclo[3.2.0]heptane-2,4-dione?
The InChIKey is RUSUJAKXQJRXRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2/c8-6-3-7(9)5-2-1-4(5)6/h4-5H,1-3H2.
What are the key properties of bicyclo[3.2.0]heptane-2,4-dione?
bicyclo[3.2.0]heptane-2,4-dione has a molecular weight of 124.14 g/mol, XLogP of 0.55, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.2.0]heptane-2,4-dione is sourced from PubChem (CID 59558535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).