C18H26BN3O2 — CID 59558608
2-(4-methylpiperazin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (PubChem CID 59558608) has the molecular formula C18H26BN3O2 and a molecular weight of 327.24 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile.
| Compound Name | 2-(4-methylpiperazin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 59558608 |
| Molecular Formula | C18H26BN3O2 |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| SMILES | CN1CCN(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2C#N)CC1 |
| InChI | InChI=1S/C18H26BN3O2/c1-17(2)18(3,4)24-19(23-17)15-6-7-16(14(12-15)13-20)22-10-8-21(5)9-11-22/h6-7,12H,8-11H2,1-5H3 |
| InChIKey | HDRSBFNKRIXBAX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 48.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|