About CID 59558621
CID 59558621 (PubChem CID 59558621) has the molecular formula C28H31N5O2
and a molecular weight of 469.59 g/mol.
Molecular Properties
| Compound Name | CID 59558621 |
| PubChem CID | 59558621 |
| Molecular Formula | C28H31N5O2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | — |
| SMILES | CCN1CC2(C1)c1[nH]c3c(c1C(=O)NC21CC1)CCc1cnc(-c2ccc(OC(C)C)nc2)cc1-3 |
| InChI | InChI=1S/C28H31N5O2/c1-4-33-14-27(15-33)25-23(26(34)32-28(27)9-10-28)19-7-5-17-12-29-21(11-20(17)24(19)31-25)18-6-8-22(30-13-18)35-16(2)3/h6,8,11-13,16,31H,4-5,7,9-10,14-15H2,1-3H3,(H,32,34) |
| InChIKey | IKPLZJAWMCKPKQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 59558621 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59558621?
The IUPAC name of CID 59558621 (CID 59558621) is not available.
What is the SMILES notation for CID 59558621?
The canonical SMILES for CID 59558621 is CCN1CC2(C1)c1[nH]c3c(c1C(=O)NC21CC1)CCc1cnc(-c2ccc(OC(C)C)nc2)cc1-3.
What is the InChIKey of CID 59558621?
The InChIKey is IKPLZJAWMCKPKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H31N5O2/c1-4-33-14-27(15-33)25-23(26(34)32-28(27)9-10-28)19-7-5-17-12-29-21(11-20(17)24(19)31-25)18-6-8-22(30-13-18)35-16(2)3/h6,8,11-13,16,31H,4-5,7,9-10,14-15H2,1-3H3,(H,32,34).
What are the key properties of CID 59558621?
CID 59558621 has a molecular weight of 469.59 g/mol, XLogP of 3.87, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59558621 is sourced from PubChem (CID 59558621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).