About methyl (4S,5R)-4,6-dihydroxy-5-tri(propan-2-yl)silyloxyhexanoate
methyl (4S,5R)-4,6-dihydroxy-5-tri(propan-2-yl)silyloxyhexanoate (PubChem CID 59558891) has the molecular formula C16H34O5Si
and a molecular weight of 334.53 g/mol. Its IUPAC name is methyl (4S,5R)-4,6-dihydroxy-5-tri(propan-2-yl)silyloxyhexanoate.
Molecular Properties
| Compound Name | methyl (4S,5R)-4,6-dihydroxy-5-tri(propan-2-yl)silyloxyhexanoate |
| PubChem CID | 59558891 |
| Molecular Formula | C16H34O5Si |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | methyl (4S,5R)-4,6-dihydroxy-5-tri(propan-2-yl)silyloxyhexanoate |
| SMILES | COC(=O)CC[C@H](O)[C@@H](CO)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H34O5Si/c1-11(2)22(12(3)4,13(5)6)21-15(10-17)14(18)8-9-16(19)20-7/h11-15,17-18H,8-10H2,1-7H3/t14-,15+/m0/s1 |
| InChIKey | MJTFYLDQRWMYGL-LSDHHAIUSA-N |
| XLogP | 2.85 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl (4S,5R)-4,6-dihydroxy-5-tri(propan-2-yl)silyloxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4S,5R)-4,6-dihydroxy-5-tri(propan-2-yl)silyloxyhexanoate?
The IUPAC name of methyl (4S,5R)-4,6-dihydroxy-5-tri(propan-2-yl)silyloxyhexanoate (CID 59558891) is methyl (4S,5R)-4,6-dihydroxy-5-tri(propan-2-yl)silyloxyhexanoate.
What is the SMILES notation for methyl (4S,5R)-4,6-dihydroxy-5-tri(propan-2-yl)silyloxyhexanoate?
The canonical SMILES for methyl (4S,5R)-4,6-dihydroxy-5-tri(propan-2-yl)silyloxyhexanoate is COC(=O)CC[C@H](O)[C@@H](CO)O[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of methyl (4S,5R)-4,6-dihydroxy-5-tri(propan-2-yl)silyloxyhexanoate?
The InChIKey is MJTFYLDQRWMYGL-LSDHHAIUSA-N. The full InChI is InChI=1S/C16H34O5Si/c1-11(2)22(12(3)4,13(5)6)21-15(10-17)14(18)8-9-16(19)20-7/h11-15,17-18H,8-10H2,1-7H3/t14-,15+/m0/s1.
What are the key properties of methyl (4S,5R)-4,6-dihydroxy-5-tri(propan-2-yl)silyloxyhexanoate?
methyl (4S,5R)-4,6-dihydroxy-5-tri(propan-2-yl)silyloxyhexanoate has a molecular weight of 334.53 g/mol, XLogP of 2.85, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4S,5R)-4,6-dihydroxy-5-tri(propan-2-yl)silyloxyhexanoate is sourced from PubChem (CID 59558891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).