C41H70O6Si — CID 59558900
methyl (2E,4E,6S,7S,9E,11E,15R,16R)-4,6,9,15-tetramethyl-7-[(E)-7-oxonon-2-enoyl]oxy-16-tri(propan-2-yl)silyloxyoctadeca-2,4,9,11-tetraenoate (PubChem CID 59558900) has the molecular formula C41H70O6Si and a molecular weight of 687.09 g/mol. Its IUPAC name is methyl (2E,4E,6S,7S,9E,11E,15R,16R)-4,6,9,15-tetramethyl-7-[(E)-7-oxonon-2-enoyl]oxy-16-tri(propan-2-yl)silyloxyoctadeca-2,4,9,11-tetraenoate.
| Compound Name | methyl (2E,4E,6S,7S,9E,11E,15R,16R)-4,6,9,15-tetramethyl-7-[(E)-7-oxonon-2-enoyl]oxy-16-tri(propan-2-yl)silyloxyoctadeca-2,4,9,11-tetraenoate |
|---|---|
| PubChem CID | 59558900 |
| Molecular Formula | C41H70O6Si |
| Molecular Weight | 687.09 g/mol |
| Exact Mass | 686.49 |
| IUPAC Name | methyl (2E,4E,6S,7S,9E,11E,15R,16R)-4,6,9,15-tetramethyl-7-[(E)-7-oxonon-2-enoyl]oxy-16-tri(propan-2-yl)silyloxyoctadeca-2,4,9,11-tetraenoate |
| SMILES | CCC(=O)CCC/C=C/C(=O)O[C@@H](C/C(C)=C/C=C/CC[C@@H](C)[C@@H](CC)O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)/C=C(C)/C=C/C(=O)OC |
| InChI | InChI=1S/C41H70O6Si/c1-14-37(42)24-20-17-21-25-41(44)46-39(36(12)28-34(10)26-27-40(43)45-13)29-33(9)22-18-16-19-23-35(11)38(15-2)47-48(30(3)4,31(5)6)32(7)8/h16,18,21-22,25-28,30-32,35-36,38-39H,14-15,17,19-20,23-24,29H2,1-13H3/b18-16+,25-21+,27-26+,33-22+,34-28+/t35-,36+,38-,39+/m1/s1 |
| InChIKey | WAHVRRDEZIZTSU-AWKBSUMJSA-N |
| XLogP | 11.19 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.09 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|