About [(E,3R,4S)-4-methylnon-7-en-3-yl]oxy-tri(propan-2-yl)silane
[(E,3R,4S)-4-methylnon-7-en-3-yl]oxy-tri(propan-2-yl)silane (PubChem CID 59558906) has the molecular formula C19H40OSi
and a molecular weight of 312.61 g/mol. Its IUPAC name is [(E,3R,4S)-4-methylnon-7-en-3-yl]oxy-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | [(E,3R,4S)-4-methylnon-7-en-3-yl]oxy-tri(propan-2-yl)silane |
| PubChem CID | 59558906 |
| Molecular Formula | C19H40OSi |
| Molecular Weight | 312.61 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | [(E,3R,4S)-4-methylnon-7-en-3-yl]oxy-tri(propan-2-yl)silane |
| SMILES | C/C=C/CC[C@H](C)[C@@H](CC)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H40OSi/c1-10-12-13-14-18(9)19(11-2)20-21(15(3)4,16(5)6)17(7)8/h10,12,15-19H,11,13-14H2,1-9H3/b12-10+/t18-,19+/m0/s1 |
| InChIKey | PMLCXAQUWOPQNJ-GMIBQGTOSA-N |
| XLogP | 6.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.61 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E,3R,4S)-4-methylnon-7-en-3-yl]oxy-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,3R,4S)-4-methylnon-7-en-3-yl]oxy-tri(propan-2-yl)silane?
The IUPAC name of [(E,3R,4S)-4-methylnon-7-en-3-yl]oxy-tri(propan-2-yl)silane (CID 59558906) is [(E,3R,4S)-4-methylnon-7-en-3-yl]oxy-tri(propan-2-yl)silane.
What is the SMILES notation for [(E,3R,4S)-4-methylnon-7-en-3-yl]oxy-tri(propan-2-yl)silane?
The canonical SMILES for [(E,3R,4S)-4-methylnon-7-en-3-yl]oxy-tri(propan-2-yl)silane is C/C=C/CC[C@H](C)[C@@H](CC)O[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of [(E,3R,4S)-4-methylnon-7-en-3-yl]oxy-tri(propan-2-yl)silane?
The InChIKey is PMLCXAQUWOPQNJ-GMIBQGTOSA-N. The full InChI is InChI=1S/C19H40OSi/c1-10-12-13-14-18(9)19(11-2)20-21(15(3)4,16(5)6)17(7)8/h10,12,15-19H,11,13-14H2,1-9H3/b12-10+/t18-,19+/m0/s1.
What are the key properties of [(E,3R,4S)-4-methylnon-7-en-3-yl]oxy-tri(propan-2-yl)silane?
[(E,3R,4S)-4-methylnon-7-en-3-yl]oxy-tri(propan-2-yl)silane has a molecular weight of 312.61 g/mol, XLogP of 6.95, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,3R,4S)-4-methylnon-7-en-3-yl]oxy-tri(propan-2-yl)silane is sourced from PubChem (CID 59558906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).