C14H15F13O3 — CID 59559040
2-methyl-1-[2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]butane (PubChem CID 59559040) has the molecular formula C14H15F13O3 and a molecular weight of 478.25 g/mol. Its IUPAC name is 2-methyl-1-[2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]butane.
| Compound Name | 2-methyl-1-[2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]butane |
|---|---|
| PubChem CID | 59559040 |
| Molecular Formula | C14H15F13O3 |
| Molecular Weight | 478.25 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 2-methyl-1-[2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]butane |
| SMILES | C=C(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(COCC(C)CC)C(F)(F)F |
| InChI | InChI=1S/C14H15F13O3/c1-4-7(2)5-28-6-9(16,12(20,21)22)29-14(26,27)11(19,13(23,24)25)30-10(17,18)8(3)15/h7H,3-6H2,1-2H3 |
| InChIKey | XFZJTGBSCUHLNT-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.25 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |