C8H8F8O2 — CID 59559041
1,1,2,2-tetrafluoro-1-(2-fluoroethoxy)-3-(1,1,2-trifluoroprop-2-enoxy)propane (PubChem CID 59559041) has the molecular formula C8H8F8O2 and a molecular weight of 288.13 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-1-(2-fluoroethoxy)-3-(1,1,2-trifluoroprop-2-enoxy)propane.
| Compound Name | 1,1,2,2-tetrafluoro-1-(2-fluoroethoxy)-3-(1,1,2-trifluoroprop-2-enoxy)propane |
|---|---|
| PubChem CID | 59559041 |
| Molecular Formula | C8H8F8O2 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 1,1,2,2-tetrafluoro-1-(2-fluoroethoxy)-3-(1,1,2-trifluoroprop-2-enoxy)propane |
| SMILES | C=C(F)C(F)(F)OCC(F)(F)C(F)(F)OCCF |
| InChI | InChI=1S/C8H8F8O2/c1-5(10)7(13,14)18-4-6(11,12)8(15,16)17-3-2-9/h1-4H2 |
| InChIKey | KWMFRDOMFJOEOH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|