About 1-[(3S)-2,5-dioxohexan-3-yl]-3-ethenylurea
1-[(3S)-2,5-dioxohexan-3-yl]-3-ethenylurea (PubChem CID 59559122) has the molecular formula C9H14N2O3
and a molecular weight of 198.22 g/mol. Its IUPAC name is 1-[(3S)-2,5-dioxohexan-3-yl]-3-ethenylurea.
Molecular Properties
| Compound Name | 1-[(3S)-2,5-dioxohexan-3-yl]-3-ethenylurea |
| PubChem CID | 59559122 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 1-[(3S)-2,5-dioxohexan-3-yl]-3-ethenylurea |
| SMILES | C=CNC(=O)N[C@@H](CC(C)=O)C(C)=O |
| InChI | InChI=1S/C9H14N2O3/c1-4-10-9(14)11-8(7(3)13)5-6(2)12/h4,8H,1,5H2,2-3H3,(H2,10,11,14)/t8-/m0/s1 |
| InChIKey | CHBZLCQKCCMITK-QMMMGPOBSA-N |
| XLogP | 0.37 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3S)-2,5-dioxohexan-3-yl]-3-ethenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-2,5-dioxohexan-3-yl]-3-ethenylurea?
The IUPAC name of 1-[(3S)-2,5-dioxohexan-3-yl]-3-ethenylurea (CID 59559122) is 1-[(3S)-2,5-dioxohexan-3-yl]-3-ethenylurea.
What is the SMILES notation for 1-[(3S)-2,5-dioxohexan-3-yl]-3-ethenylurea?
The canonical SMILES for 1-[(3S)-2,5-dioxohexan-3-yl]-3-ethenylurea is C=CNC(=O)N[C@@H](CC(C)=O)C(C)=O.
What is the InChIKey of 1-[(3S)-2,5-dioxohexan-3-yl]-3-ethenylurea?
The InChIKey is CHBZLCQKCCMITK-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H14N2O3/c1-4-10-9(14)11-8(7(3)13)5-6(2)12/h4,8H,1,5H2,2-3H3,(H2,10,11,14)/t8-/m0/s1.
What are the key properties of 1-[(3S)-2,5-dioxohexan-3-yl]-3-ethenylurea?
1-[(3S)-2,5-dioxohexan-3-yl]-3-ethenylurea has a molecular weight of 198.22 g/mol, XLogP of 0.37, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-2,5-dioxohexan-3-yl]-3-ethenylurea is sourced from PubChem (CID 59559122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).