About 2,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid
2,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid (PubChem CID 59559143) has the molecular formula C8H14O5
and a molecular weight of 190.19 g/mol. Its IUPAC name is 2,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid.
Molecular Properties
| Compound Name | 2,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid |
| PubChem CID | 59559143 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 2,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid |
| SMILES | CC1OC(O)(C(=O)O)CC(O)C1C |
| InChI | InChI=1S/C8H14O5/c1-4-5(2)13-8(12,7(10)11)3-6(4)9/h4-6,9,12H,3H2,1-2H3,(H,10,11) |
| InChIKey | RJSKCDAGRMJNNC-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid?
The IUPAC name of 2,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid (CID 59559143) is 2,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid.
What is the SMILES notation for 2,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid?
The canonical SMILES for 2,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid is CC1OC(O)(C(=O)O)CC(O)C1C.
What is the InChIKey of 2,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid?
The InChIKey is RJSKCDAGRMJNNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O5/c1-4-5(2)13-8(12,7(10)11)3-6(4)9/h4-6,9,12H,3H2,1-2H3,(H,10,11).
What are the key properties of 2,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid?
2,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid has a molecular weight of 190.19 g/mol, XLogP of -0.43, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid is sourced from PubChem (CID 59559143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).