About 1,1-bis[butan-2-yl(difluoro)silyl]-2,2-dimethylhydrazine
1,1-bis[butan-2-yl(difluoro)silyl]-2,2-dimethylhydrazine (PubChem CID 595592) has the molecular formula C10H24F4N2Si2
and a molecular weight of 304.48 g/mol. Its IUPAC name is 1,1-bis[butan-2-yl(difluoro)silyl]-2,2-dimethylhydrazine.
Molecular Properties
| Compound Name | 1,1-bis[butan-2-yl(difluoro)silyl]-2,2-dimethylhydrazine |
| PubChem CID | 595592 |
| Molecular Formula | C10H24F4N2Si2 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1,1-bis[butan-2-yl(difluoro)silyl]-2,2-dimethylhydrazine |
| SMILES | CCC(C)[Si](F)(F)N(N(C)C)[Si](F)(F)C(C)CC |
| InChI | InChI=1S/C10H24F4N2Si2/c1-7-9(3)17(11,12)16(15(5)6)18(13,14)10(4)8-2/h9-10H,7-8H2,1-6H3 |
| InChIKey | RNRRWCUWVCZCRX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 1,1-bis[butan-2-yl(difluoro)silyl]-2,2-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-bis[butan-2-yl(difluoro)silyl]-2,2-dimethylhydrazine?
The IUPAC name of 1,1-bis[butan-2-yl(difluoro)silyl]-2,2-dimethylhydrazine (CID 595592) is 1,1-bis[butan-2-yl(difluoro)silyl]-2,2-dimethylhydrazine.
What is the SMILES notation for 1,1-bis[butan-2-yl(difluoro)silyl]-2,2-dimethylhydrazine?
The canonical SMILES for 1,1-bis[butan-2-yl(difluoro)silyl]-2,2-dimethylhydrazine is CCC(C)[Si](F)(F)N(N(C)C)[Si](F)(F)C(C)CC.
What is the InChIKey of 1,1-bis[butan-2-yl(difluoro)silyl]-2,2-dimethylhydrazine?
The InChIKey is RNRRWCUWVCZCRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24F4N2Si2/c1-7-9(3)17(11,12)16(15(5)6)18(13,14)10(4)8-2/h9-10H,7-8H2,1-6H3.
What are the key properties of 1,1-bis[butan-2-yl(difluoro)silyl]-2,2-dimethylhydrazine?
1,1-bis[butan-2-yl(difluoro)silyl]-2,2-dimethylhydrazine has a molecular weight of 304.48 g/mol, XLogP of 4.12, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-bis[butan-2-yl(difluoro)silyl]-2,2-dimethylhydrazine is sourced from PubChem (CID 595592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).