About 1,2-di(propan-2-yl)-3,6-dihydro-2H-pyridine
1,2-di(propan-2-yl)-3,6-dihydro-2H-pyridine (PubChem CID 59559392) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is 1,2-di(propan-2-yl)-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1,2-di(propan-2-yl)-3,6-dihydro-2H-pyridine |
| PubChem CID | 59559392 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 1,2-di(propan-2-yl)-3,6-dihydro-2H-pyridine |
| SMILES | CC(C)C1CC=CCN1C(C)C |
| InChI | InChI=1S/C11H21N/c1-9(2)11-7-5-6-8-12(11)10(3)4/h5-6,9-11H,7-8H2,1-4H3 |
| InChIKey | PISBQFVDKDHSOH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-di(propan-2-yl)-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-di(propan-2-yl)-3,6-dihydro-2H-pyridine?
The IUPAC name of 1,2-di(propan-2-yl)-3,6-dihydro-2H-pyridine (CID 59559392) is 1,2-di(propan-2-yl)-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 1,2-di(propan-2-yl)-3,6-dihydro-2H-pyridine?
The canonical SMILES for 1,2-di(propan-2-yl)-3,6-dihydro-2H-pyridine is CC(C)C1CC=CCN1C(C)C.
What is the InChIKey of 1,2-di(propan-2-yl)-3,6-dihydro-2H-pyridine?
The InChIKey is PISBQFVDKDHSOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N/c1-9(2)11-7-5-6-8-12(11)10(3)4/h5-6,9-11H,7-8H2,1-4H3.
What are the key properties of 1,2-di(propan-2-yl)-3,6-dihydro-2H-pyridine?
1,2-di(propan-2-yl)-3,6-dihydro-2H-pyridine has a molecular weight of 167.30 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-di(propan-2-yl)-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 59559392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).