About N-[(2S)-1-hydroxy-2,3-dimethylbutan-2-yl]methanesulfonamide
N-[(2S)-1-hydroxy-2,3-dimethylbutan-2-yl]methanesulfonamide (PubChem CID 59560469) has the molecular formula C7H17NO3S
and a molecular weight of 195.28 g/mol. Its IUPAC name is N-[(2S)-1-hydroxy-2,3-dimethylbutan-2-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[(2S)-1-hydroxy-2,3-dimethylbutan-2-yl]methanesulfonamide |
| PubChem CID | 59560469 |
| Molecular Formula | C7H17NO3S |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | N-[(2S)-1-hydroxy-2,3-dimethylbutan-2-yl]methanesulfonamide |
| SMILES | CC(C)[C@@](C)(CO)NS(C)(=O)=O |
| InChI | InChI=1S/C7H17NO3S/c1-6(2)7(3,5-9)8-12(4,10)11/h6,8-9H,5H2,1-4H3/t7-/m1/s1 |
| InChIKey | YXJNWAIWXQGRQQ-SSDOTTSWSA-N |
| XLogP | -0.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2S)-1-hydroxy-2,3-dimethylbutan-2-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-1-hydroxy-2,3-dimethylbutan-2-yl]methanesulfonamide?
The IUPAC name of N-[(2S)-1-hydroxy-2,3-dimethylbutan-2-yl]methanesulfonamide (CID 59560469) is N-[(2S)-1-hydroxy-2,3-dimethylbutan-2-yl]methanesulfonamide.
What is the SMILES notation for N-[(2S)-1-hydroxy-2,3-dimethylbutan-2-yl]methanesulfonamide?
The canonical SMILES for N-[(2S)-1-hydroxy-2,3-dimethylbutan-2-yl]methanesulfonamide is CC(C)[C@@](C)(CO)NS(C)(=O)=O.
What is the InChIKey of N-[(2S)-1-hydroxy-2,3-dimethylbutan-2-yl]methanesulfonamide?
The InChIKey is YXJNWAIWXQGRQQ-SSDOTTSWSA-N. The full InChI is InChI=1S/C7H17NO3S/c1-6(2)7(3,5-9)8-12(4,10)11/h6,8-9H,5H2,1-4H3/t7-/m1/s1.
What are the key properties of N-[(2S)-1-hydroxy-2,3-dimethylbutan-2-yl]methanesulfonamide?
N-[(2S)-1-hydroxy-2,3-dimethylbutan-2-yl]methanesulfonamide has a molecular weight of 195.28 g/mol, XLogP of -0.06, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-1-hydroxy-2,3-dimethylbutan-2-yl]methanesulfonamide is sourced from PubChem (CID 59560469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).