About 4-ethynyl-2,1,3-benzothiadiazole
4-ethynyl-2,1,3-benzothiadiazole (PubChem CID 59560500) has the molecular formula C8H4N2S
and a molecular weight of 160.20 g/mol. Its IUPAC name is 4-ethynyl-2,1,3-benzothiadiazole.
Molecular Properties
| Compound Name | 4-ethynyl-2,1,3-benzothiadiazole |
| PubChem CID | 59560500 |
| Molecular Formula | C8H4N2S |
| Molecular Weight | 160.20 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | 4-ethynyl-2,1,3-benzothiadiazole |
| SMILES | C#Cc1cccc2nsnc12 |
| InChI | InChI=1S/C8H4N2S/c1-2-6-4-3-5-7-8(6)10-11-9-7/h1,3-5H |
| InChIKey | RECNVYYEGBVTCZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynyl-2,1,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynyl-2,1,3-benzothiadiazole?
The IUPAC name of 4-ethynyl-2,1,3-benzothiadiazole (CID 59560500) is 4-ethynyl-2,1,3-benzothiadiazole.
What is the SMILES notation for 4-ethynyl-2,1,3-benzothiadiazole?
The canonical SMILES for 4-ethynyl-2,1,3-benzothiadiazole is C#Cc1cccc2nsnc12.
What is the InChIKey of 4-ethynyl-2,1,3-benzothiadiazole?
The InChIKey is RECNVYYEGBVTCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2S/c1-2-6-4-3-5-7-8(6)10-11-9-7/h1,3-5H.
What are the key properties of 4-ethynyl-2,1,3-benzothiadiazole?
4-ethynyl-2,1,3-benzothiadiazole has a molecular weight of 160.20 g/mol, XLogP of 1.67, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynyl-2,1,3-benzothiadiazole is sourced from PubChem (CID 59560500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).