C25H25FN6OS — CID 59560623
N-[(7-fluoro-3,4-dihydro-2H-1,4-benzothiazin-6-yl)methyl]-2-(6-methoxy-1,5-naphthyridin-4-yl)-4,5,6,7-tetrahydroindazol-5-amine (PubChem CID 59560623) has the molecular formula C25H25FN6OS and a molecular weight of 476.58 g/mol. Its IUPAC name is N-[(7-fluoro-3,4-dihydro-2H-1,4-benzothiazin-6-yl)methyl]-2-(6-methoxy-1,5-naphthyridin-4-yl)-4,5,6,7-tetrahydroindazol-5-amine.
| Compound Name | N-[(7-fluoro-3,4-dihydro-2H-1,4-benzothiazin-6-yl)methyl]-2-(6-methoxy-1,5-naphthyridin-4-yl)-4,5,6,7-tetrahydroindazol-5-amine |
|---|---|
| PubChem CID | 59560623 |
| Molecular Formula | C25H25FN6OS |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | N-[(7-fluoro-3,4-dihydro-2H-1,4-benzothiazin-6-yl)methyl]-2-(6-methoxy-1,5-naphthyridin-4-yl)-4,5,6,7-tetrahydroindazol-5-amine |
| SMILES | COc1ccc2nccc(-n3cc4c(n3)CCC(NCc3cc5c(cc3F)SCCN5)C4)c2n1 |
| InChI | InChI=1S/C25H25FN6OS/c1-33-24-5-4-20-25(30-24)22(6-7-27-20)32-14-16-10-17(2-3-19(16)31-32)29-13-15-11-21-23(12-18(15)26)34-9-8-28-21/h4-7,11-12,14,17,28-29H,2-3,8-10,13H2,1H3 |
| InChIKey | FUNZUKAHWDFLHP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |