C15H23NO6 — CID 59560685
methyl (1S,2S,6R,9S)-9-tert-butyl-4-hydroxy-2-methyl-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate (PubChem CID 59560685) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is methyl (1S,2S,6R,9S)-9-tert-butyl-4-hydroxy-2-methyl-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate.
| Compound Name | methyl (1S,2S,6R,9S)-9-tert-butyl-4-hydroxy-2-methyl-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate |
|---|---|
| PubChem CID | 59560685 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | methyl (1S,2S,6R,9S)-9-tert-butyl-4-hydroxy-2-methyl-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate |
| SMILES | COC(=O)[C@@]12CO[C@@H](C(C)(C)C)N1C(=O)[C@@H]1CC(O)O[C@@]12C |
| InChI | InChI=1S/C15H23NO6/c1-13(2,3)11-16-10(18)8-6-9(17)22-14(8,4)15(16,7-21-11)12(19)20-5/h8-9,11,17H,6-7H2,1-5H3/t8-,9?,11-,14-,15+/m0/s1 |
| InChIKey | AKQXUPYEFYTXSF-DCBUZLHFSA-N |
| XLogP | 0.26 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |