About 7-ethoxy-2,3,7-trimethyloctanal
7-ethoxy-2,3,7-trimethyloctanal (PubChem CID 59560846) has the molecular formula C13H26O2
and a molecular weight of 214.35 g/mol. Its IUPAC name is 7-ethoxy-2,3,7-trimethyloctanal.
Molecular Properties
| Compound Name | 7-ethoxy-2,3,7-trimethyloctanal |
| PubChem CID | 59560846 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 7-ethoxy-2,3,7-trimethyloctanal |
| SMILES | CCOC(C)(C)CCCC(C)C(C)C=O |
| InChI | InChI=1S/C13H26O2/c1-6-15-13(4,5)9-7-8-11(2)12(3)10-14/h10-12H,6-9H2,1-5H3 |
| InChIKey | CPOSUELHLYWZMU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7-ethoxy-2,3,7-trimethyloctanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethoxy-2,3,7-trimethyloctanal?
The IUPAC name of 7-ethoxy-2,3,7-trimethyloctanal (CID 59560846) is 7-ethoxy-2,3,7-trimethyloctanal.
What is the SMILES notation for 7-ethoxy-2,3,7-trimethyloctanal?
The canonical SMILES for 7-ethoxy-2,3,7-trimethyloctanal is CCOC(C)(C)CCCC(C)C(C)C=O.
What is the InChIKey of 7-ethoxy-2,3,7-trimethyloctanal?
The InChIKey is CPOSUELHLYWZMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2/c1-6-15-13(4,5)9-7-8-11(2)12(3)10-14/h10-12H,6-9H2,1-5H3.
What are the key properties of 7-ethoxy-2,3,7-trimethyloctanal?
7-ethoxy-2,3,7-trimethyloctanal has a molecular weight of 214.35 g/mol, XLogP of 3.44, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethoxy-2,3,7-trimethyloctanal is sourced from PubChem (CID 59560846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).