C19H18ClN7O — CID 59561348
3-amino-2-chloro-4-[2-(2-imidazol-1-ylethylamino)pyrazolo[1,5-a]pyridin-3-yl]imino-6-methylcyclohexa-2,5-dien-1-one (PubChem CID 59561348) has the molecular formula C19H18ClN7O and a molecular weight of 395.85 g/mol. Its IUPAC name is 3-amino-2-chloro-4-[2-(2-imidazol-1-ylethylamino)pyrazolo[1,5-a]pyridin-3-yl]imino-6-methylcyclohexa-2,5-dien-1-one.
| Compound Name | 3-amino-2-chloro-4-[2-(2-imidazol-1-ylethylamino)pyrazolo[1,5-a]pyridin-3-yl]imino-6-methylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 59561348 |
| Molecular Formula | C19H18ClN7O |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 3-amino-2-chloro-4-[2-(2-imidazol-1-ylethylamino)pyrazolo[1,5-a]pyridin-3-yl]imino-6-methylcyclohexa-2,5-dien-1-one |
| SMILES | CC1=C/C(=N\c2c(NCCn3ccnc3)nn3ccccc23)C(N)=C(Cl)C1=O |
| InChI | InChI=1S/C19H18ClN7O/c1-12-10-13(16(21)15(20)18(12)28)24-17-14-4-2-3-7-27(14)25-19(17)23-6-9-26-8-5-22-11-26/h2-5,7-8,10-11H,6,9,21H2,1H3,(H,23,25)/b24-13+ |
| InChIKey | DJSUOPCBMMKYEX-ZMOGYAJESA-N |
| XLogP | 2.65 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|