C19H23ClN6O — CID 59561364
3-amino-2-chloro-4-[2-[3-(dimethylamino)propylamino]pyrazolo[1,5-a]pyridin-3-yl]imino-6-methylcyclohexa-2,5-dien-1-one (PubChem CID 59561364) has the molecular formula C19H23ClN6O and a molecular weight of 386.89 g/mol. Its IUPAC name is 3-amino-2-chloro-4-[2-[3-(dimethylamino)propylamino]pyrazolo[1,5-a]pyridin-3-yl]imino-6-methylcyclohexa-2,5-dien-1-one.
| Compound Name | 3-amino-2-chloro-4-[2-[3-(dimethylamino)propylamino]pyrazolo[1,5-a]pyridin-3-yl]imino-6-methylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 59561364 |
| Molecular Formula | C19H23ClN6O |
| Molecular Weight | 386.89 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 3-amino-2-chloro-4-[2-[3-(dimethylamino)propylamino]pyrazolo[1,5-a]pyridin-3-yl]imino-6-methylcyclohexa-2,5-dien-1-one |
| SMILES | CC1=C/C(=N\c2c(NCCCN(C)C)nn3ccccc23)C(N)=C(Cl)C1=O |
| InChI | InChI=1S/C19H23ClN6O/c1-12-11-13(16(21)15(20)18(12)27)23-17-14-7-4-5-10-26(14)24-19(17)22-8-6-9-25(2)3/h4-5,7,10-11H,6,8-9,21H2,1-3H3,(H,22,24)/b23-13+ |
| InChIKey | CTDHTWJLWWATCL-YDZHTSKRSA-N |
| XLogP | 2.71 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.89 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|