C19H20N7O+ — CID 59561454
3-amino-4-[2-[2-(3-methylimidazol-3-ium-1-yl)ethylamino]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-2,5-dien-1-one (PubChem CID 59561454) has the molecular formula C19H20N7O+ and a molecular weight of 362.42 g/mol. Its IUPAC name is 3-amino-4-[2-[2-(3-methylimidazol-3-ium-1-yl)ethylamino]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-2,5-dien-1-one.
| Compound Name | 3-amino-4-[2-[2-(3-methylimidazol-3-ium-1-yl)ethylamino]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 59561454 |
| Molecular Formula | C19H20N7O+ |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 3-amino-4-[2-[2-(3-methylimidazol-3-ium-1-yl)ethylamino]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-2,5-dien-1-one |
| SMILES | C[n+]1ccn(CCNc2nn3ccccc3c2/N=C2\C=CC(=O)C=C2N)c1 |
| InChI | InChI=1S/C19H19N7O/c1-24-10-11-25(13-24)9-7-21-19-18(17-4-2-3-8-26(17)23-19)22-16-6-5-14(27)12-15(16)20/h2-6,8,10-13H,7,9H2,1H3,(H2-,20,21,23,27)/p+1/b22-16+ |
| InChIKey | PCDIZUWWKZXNPI-CJLVFECKSA-O |
| XLogP | 1.13 |
| TPSA | 93.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|