C20H21ClN7O+ — CID 59561467
3-amino-2-chloro-6-methyl-4-[2-[2-(3-methylimidazol-3-ium-1-yl)ethylamino]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-2,5-dien-1-one (PubChem CID 59561467) has the molecular formula C20H21ClN7O+ and a molecular weight of 410.89 g/mol. Its IUPAC name is 3-amino-2-chloro-6-methyl-4-[2-[2-(3-methylimidazol-3-ium-1-yl)ethylamino]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-2,5-dien-1-one.
| Compound Name | 3-amino-2-chloro-6-methyl-4-[2-[2-(3-methylimidazol-3-ium-1-yl)ethylamino]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 59561467 |
| Molecular Formula | C20H21ClN7O+ |
| Molecular Weight | 410.89 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 3-amino-2-chloro-6-methyl-4-[2-[2-(3-methylimidazol-3-ium-1-yl)ethylamino]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-2,5-dien-1-one |
| SMILES | CC1=C/C(=N\c2c(NCCn3cc[n+](C)c3)nn3ccccc23)C(N)=C(Cl)C1=O |
| InChI | InChI=1S/C20H20ClN7O/c1-13-11-14(17(22)16(21)19(13)29)24-18-15-5-3-4-7-28(15)25-20(18)23-6-8-27-10-9-26(2)12-27/h3-5,7,9-12H,6,8H2,1-2H3,(H2-,22,23,25,29)/p+1/b24-14+ |
| InChIKey | KURLUOYYIBSWDA-ZVHZXABRSA-O |
| XLogP | 2.08 |
| TPSA | 93.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.89 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|