C20H25N6O+ — CID 59561493
3-amino-6-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethylamino]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-2,4-dien-1-one (PubChem CID 59561493) has the molecular formula C20H25N6O+ and a molecular weight of 365.46 g/mol. Its IUPAC name is 3-amino-6-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethylamino]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-2,4-dien-1-one.
| Compound Name | 3-amino-6-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethylamino]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 59561493 |
| Molecular Formula | C20H25N6O+ |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 3-amino-6-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethylamino]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-2,4-dien-1-one |
| SMILES | C[N+]1(CCNc2nn3ccccc3c2/N=C2\C=CC(N)=CC2=O)CCCC1 |
| InChI | InChI=1S/C20H24N6O/c1-26(11-4-5-12-26)13-9-22-20-19(17-6-2-3-10-25(17)24-20)23-16-8-7-15(21)14-18(16)27/h2-3,6-8,10,14H,4-5,9,11-13H2,1H3,(H2-,21,22,24,27)/p+1/b23-16+ |
| InChIKey | XJEIYGNSTVSZCV-XQNSMLJCSA-O |
| XLogP | 2.04 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|