C18H22N5O2+ — CID 59561498
2-[[3-[(2-hydroxy-4-oxocyclohexa-2,5-dien-1-ylidene)amino]pyrazolo[1,5-a]pyridin-2-yl]amino]ethyl-trimethylazanium (PubChem CID 59561498) has the molecular formula C18H22N5O2+ and a molecular weight of 340.41 g/mol. Its IUPAC name is 2-[[3-[(2-hydroxy-4-oxocyclohexa-2,5-dien-1-ylidene)amino]pyrazolo[1,5-a]pyridin-2-yl]amino]ethyl-trimethylazanium.
| Compound Name | 2-[[3-[(2-hydroxy-4-oxocyclohexa-2,5-dien-1-ylidene)amino]pyrazolo[1,5-a]pyridin-2-yl]amino]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 59561498 |
| Molecular Formula | C18H22N5O2+ |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 2-[[3-[(2-hydroxy-4-oxocyclohexa-2,5-dien-1-ylidene)amino]pyrazolo[1,5-a]pyridin-2-yl]amino]ethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCNc1nn2ccccc2c1/N=C1\C=CC(=O)C=C1O |
| InChI | InChI=1S/C18H21N5O2/c1-23(2,3)11-9-19-18-17(15-6-4-5-10-22(15)21-18)20-14-8-7-13(24)12-16(14)25/h4-8,10,12H,9,11H2,1-3H3,(H-,19,21,24,25)/p+1/b20-14+ |
| InChIKey | AVMMZMZTTDFPKP-XSFVSMFZSA-O |
| XLogP | 2.11 |
| TPSA | 78.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|