C22H27N4O3+ — CID 59561506
3-hydroxy-2-methyl-4-[2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-2,5-dien-1-one (PubChem CID 59561506) has the molecular formula C22H27N4O3+ and a molecular weight of 395.48 g/mol. Its IUPAC name is 3-hydroxy-2-methyl-4-[2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-2,5-dien-1-one.
| Compound Name | 3-hydroxy-2-methyl-4-[2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 59561506 |
| Molecular Formula | C22H27N4O3+ |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 3-hydroxy-2-methyl-4-[2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-2,5-dien-1-one |
| SMILES | CC1=C(O)/C(=N/c2c(OCC[N+]3(C)CCCCC3)nn3ccccc23)C=CC1=O |
| InChI | InChI=1S/C22H26N4O3/c1-16-19(27)10-9-17(21(16)28)23-20-18-8-4-5-11-25(18)24-22(20)29-15-14-26(2)12-6-3-7-13-26/h4-5,8-11H,3,6-7,12-15H2,1-2H3/p+1/b23-17+ |
| InChIKey | QILIFTRVNSZRTQ-HAVVHWLPSA-O |
| XLogP | 3.39 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|