C13H26O2 — CID 59561715
(Z)-3,5-dimethoxy-2,2,6,6-tetramethylhept-3-ene (PubChem CID 59561715) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is (Z)-3,5-dimethoxy-2,2,6,6-tetramethylhept-3-ene.
| Compound Name | (Z)-3,5-dimethoxy-2,2,6,6-tetramethylhept-3-ene |
|---|---|
| PubChem CID | 59561715 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | (Z)-3,5-dimethoxy-2,2,6,6-tetramethylhept-3-ene |
| SMILES | CO/C(=C\C(OC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H26O2/c1-12(2,3)10(14-7)9-11(15-8)13(4,5)6/h9-10H,1-8H3/b11-9- |
| InChIKey | WIYQLBFIBSUMRE-LUAWRHEFSA-N |
| XLogP | 3.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|