C18H26O7 — CID 59561874
(1S,2S,3R,6S,7S,13S,16R)-7,16-dihydroxy-3,7,11,11,13-pentamethyl-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecane-4,14-dione (PubChem CID 59561874) has the molecular formula C18H26O7 and a molecular weight of 354.40 g/mol. Its IUPAC name is (1S,2S,3R,6S,7S,13S,16R)-7,16-dihydroxy-3,7,11,11,13-pentamethyl-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecane-4,14-dione.
| Compound Name | (1S,2S,3R,6S,7S,13S,16R)-7,16-dihydroxy-3,7,11,11,13-pentamethyl-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecane-4,14-dione |
|---|---|
| PubChem CID | 59561874 |
| Molecular Formula | C18H26O7 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (1S,2S,3R,6S,7S,13S,16R)-7,16-dihydroxy-3,7,11,11,13-pentamethyl-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecane-4,14-dione |
| SMILES | C[C@H]1C(=O)C[C@H]2[C@@H]1[C@@H]1OC(=O)[C@@]3(C)OC(C)(C)OC(C[C@]2(C)O)[C@@]13O |
| InChI | InChI=1S/C18H26O7/c1-8-10(19)6-9-12(8)13-18(22)11(7-16(9,4)21)24-15(2,3)25-17(18,5)14(20)23-13/h8-9,11-13,21-22H,6-7H2,1-5H3/t8-,9-,11?,12+,13-,16-,17+,18+/m0/s1 |
| InChIKey | UGCZUEWPKJBHQW-VHHLLWQNSA-N |
| XLogP | 0.55 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |