C21H31NO — CID 59562041
4-tert-butyl-2-(diethylaminomethyl)-6-[(3Z)-hexa-1,3,5-trien-2-yl]phenol (PubChem CID 59562041) has the molecular formula C21H31NO and a molecular weight of 313.49 g/mol. Its IUPAC name is 4-tert-butyl-2-(diethylaminomethyl)-6-[(3Z)-hexa-1,3,5-trien-2-yl]phenol.
| Compound Name | 4-tert-butyl-2-(diethylaminomethyl)-6-[(3Z)-hexa-1,3,5-trien-2-yl]phenol |
|---|---|
| PubChem CID | 59562041 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | 4-tert-butyl-2-(diethylaminomethyl)-6-[(3Z)-hexa-1,3,5-trien-2-yl]phenol |
| SMILES | C=C/C=C\C(=C)c1cc(C(C)(C)C)cc(CN(CC)CC)c1O |
| InChI | InChI=1S/C21H31NO/c1-8-11-12-16(4)19-14-18(21(5,6)7)13-17(20(19)23)15-22(9-2)10-3/h8,11-14,23H,1,4,9-10,15H2,2-3,5-7H3/b12-11- |
| InChIKey | VLZNJZQESAKBNR-QXMHVHEDSA-N |
| XLogP | 5.29 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|