About 2-[4,5-diiodo-3-oxo-6-(3-triethoxysilylpropoxy)xanthen-9-yl]benzoate
2-[4,5-diiodo-3-oxo-6-(3-triethoxysilylpropoxy)xanthen-9-yl]benzoate (PubChem CID 59562296) has the molecular formula C29H29I2O8Si-
and a molecular weight of 787.44 g/mol. Its IUPAC name is 2-[4,5-diiodo-3-oxo-6-(3-triethoxysilylpropoxy)xanthen-9-yl]benzoate.
Molecular Properties
| Compound Name | 2-[4,5-diiodo-3-oxo-6-(3-triethoxysilylpropoxy)xanthen-9-yl]benzoate |
| PubChem CID | 59562296 |
| Molecular Formula | C29H29I2O8Si- |
| Molecular Weight | 787.44 g/mol |
| Exact Mass | 786.97 |
| IUPAC Name | 2-[4,5-diiodo-3-oxo-6-(3-triethoxysilylpropoxy)xanthen-9-yl]benzoate |
| SMILES | CCO[Si](CCCOc1ccc2c(-c3ccccc3C(=O)[O-])c3ccc(=O)c(I)c-3oc2c1I)(OCC)OCC |
| InChI | InChI=1S/C29H30I2O8Si/c1-4-36-40(37-5-2,38-6-3)17-9-16-35-23-15-13-21-24(18-10-7-8-11-19(18)29(33)34)20-12-14-22(32)25(30)27(20)39-28(21)26(23)31/h7-8,10-15H,4-6,9,16-17H2,1-3H3,(H,33,34)/p-1 |
| InChIKey | OMLNQRXIQQVWOM-UHFFFAOYSA-M |
| XLogP | 5.95 |
| TPSA | 107.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 787.44 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4,5-diiodo-3-oxo-6-(3-triethoxysilylpropoxy)xanthen-9-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4,5-diiodo-3-oxo-6-(3-triethoxysilylpropoxy)xanthen-9-yl]benzoate?
The IUPAC name of 2-[4,5-diiodo-3-oxo-6-(3-triethoxysilylpropoxy)xanthen-9-yl]benzoate (CID 59562296) is 2-[4,5-diiodo-3-oxo-6-(3-triethoxysilylpropoxy)xanthen-9-yl]benzoate.
What is the SMILES notation for 2-[4,5-diiodo-3-oxo-6-(3-triethoxysilylpropoxy)xanthen-9-yl]benzoate?
The canonical SMILES for 2-[4,5-diiodo-3-oxo-6-(3-triethoxysilylpropoxy)xanthen-9-yl]benzoate is CCO[Si](CCCOc1ccc2c(-c3ccccc3C(=O)[O-])c3ccc(=O)c(I)c-3oc2c1I)(OCC)OCC.
What is the InChIKey of 2-[4,5-diiodo-3-oxo-6-(3-triethoxysilylpropoxy)xanthen-9-yl]benzoate?
The InChIKey is OMLNQRXIQQVWOM-UHFFFAOYSA-M. The full InChI is InChI=1S/C29H30I2O8Si/c1-4-36-40(37-5-2,38-6-3)17-9-16-35-23-15-13-21-24(18-10-7-8-11-19(18)29(33)34)20-12-14-22(32)25(30)27(20)39-28(21)26(23)31/h7-8,10-15H,4-6,9,16-17H2,1-3H3,(H,33,34)/p-1.
What are the key properties of 2-[4,5-diiodo-3-oxo-6-(3-triethoxysilylpropoxy)xanthen-9-yl]benzoate?
2-[4,5-diiodo-3-oxo-6-(3-triethoxysilylpropoxy)xanthen-9-yl]benzoate has a molecular weight of 787.44 g/mol, XLogP of 5.95, 13 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,5-diiodo-3-oxo-6-(3-triethoxysilylpropoxy)xanthen-9-yl]benzoate is sourced from PubChem (CID 59562296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).