C30H25Br4Cl4NO9Si — CID 59562380
2,3,4,5-tetrachloro-6-[2,4,5,7-tetrabromo-3-oxo-6-(3-triethoxysilylpropylcarbamoyloxy)xanthen-9-yl]benzoic acid (PubChem CID 59562380) has the molecular formula C30H25Br4Cl4NO9Si and a molecular weight of 1033.04 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[2,4,5,7-tetrabromo-3-oxo-6-(3-triethoxysilylpropylcarbamoyloxy)xanthen-9-yl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[2,4,5,7-tetrabromo-3-oxo-6-(3-triethoxysilylpropylcarbamoyloxy)xanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 59562380 |
| Molecular Formula | C30H25Br4Cl4NO9Si |
| Molecular Weight | 1033.04 g/mol |
| Exact Mass | 1026.68 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[2,4,5,7-tetrabromo-3-oxo-6-(3-triethoxysilylpropylcarbamoyloxy)xanthen-9-yl]benzoic acid |
| SMILES | CCO[Si](CCCNC(=O)Oc1c(Br)cc2c(-c3c(Cl)c(Cl)c(Cl)c(Cl)c3C(=O)O)c3cc(Br)c(=O)c(Br)c-3oc2c1Br)(OCC)OCC |
| InChI | InChI=1S/C30H25Br4Cl4NO9Si/c1-4-44-49(45-5-2,46-6-3)9-7-8-39-30(43)48-28-15(32)11-13-16(17-18(29(41)42)22(36)24(38)23(37)21(17)35)12-10-14(31)25(40)19(33)26(12)47-27(13)20(28)34/h10-11H,4-9H2,1-3H3,(H,39,43)(H,41,42) |
| InChIKey | PHGGAJPIWIRCGT-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 133.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1033.04 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|