About 3,4,6-trifluorobenzene-1,2-diamine
3,4,6-trifluorobenzene-1,2-diamine (PubChem CID 595624) has the molecular formula C6H5F3N2
and a molecular weight of 162.11 g/mol. Its IUPAC name is 3,4,6-trifluorobenzene-1,2-diamine.
Molecular Properties
| Compound Name | 3,4,6-trifluorobenzene-1,2-diamine |
| PubChem CID | 595624 |
| Molecular Formula | C6H5F3N2 |
| Molecular Weight | 162.11 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 3,4,6-trifluorobenzene-1,2-diamine |
| SMILES | Nc1c(F)cc(F)c(F)c1N |
| InChI | InChI=1S/C6H5F3N2/c7-2-1-3(8)5(10)6(11)4(2)9/h1H,10-11H2 |
| InChIKey | XQJQIIFXQHKCKF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.11 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3,4,6-trifluorobenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,6-trifluorobenzene-1,2-diamine?
The IUPAC name of 3,4,6-trifluorobenzene-1,2-diamine (CID 595624) is 3,4,6-trifluorobenzene-1,2-diamine.
What is the SMILES notation for 3,4,6-trifluorobenzene-1,2-diamine?
The canonical SMILES for 3,4,6-trifluorobenzene-1,2-diamine is Nc1c(F)cc(F)c(F)c1N.
What is the InChIKey of 3,4,6-trifluorobenzene-1,2-diamine?
The InChIKey is XQJQIIFXQHKCKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F3N2/c7-2-1-3(8)5(10)6(11)4(2)9/h1H,10-11H2.
What are the key properties of 3,4,6-trifluorobenzene-1,2-diamine?
3,4,6-trifluorobenzene-1,2-diamine has a molecular weight of 162.11 g/mol, XLogP of 1.27, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,6-trifluorobenzene-1,2-diamine is sourced from PubChem (CID 595624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).