C21H23NO3S — CID 59562436
2,2,4,4-tetramethyl-6-[5-methyl-2-(4-methylphenyl)-1,3-thiazol-4-yl]cyclohexane-1,3,5-trione (PubChem CID 59562436) has the molecular formula C21H23NO3S and a molecular weight of 369.49 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-6-[5-methyl-2-(4-methylphenyl)-1,3-thiazol-4-yl]cyclohexane-1,3,5-trione.
| Compound Name | 2,2,4,4-tetramethyl-6-[5-methyl-2-(4-methylphenyl)-1,3-thiazol-4-yl]cyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 59562436 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 2,2,4,4-tetramethyl-6-[5-methyl-2-(4-methylphenyl)-1,3-thiazol-4-yl]cyclohexane-1,3,5-trione |
| SMILES | Cc1ccc(-c2nc(C3C(=O)C(C)(C)C(=O)C(C)(C)C3=O)c(C)s2)cc1 |
| InChI | InChI=1S/C21H23NO3S/c1-11-7-9-13(10-8-11)18-22-15(12(2)26-18)14-16(23)20(3,4)19(25)21(5,6)17(14)24/h7-10,14H,1-6H3 |
| InChIKey | BSSARIYNIVCWEI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|