C24H25NO3S — CID 59562502
4-(5-ethyl-2-naphthalen-2-yl-1,3-thiazol-4-yl)-2,2,6,6-tetramethyloxane-3,5-dione (PubChem CID 59562502) has the molecular formula C24H25NO3S and a molecular weight of 407.54 g/mol. Its IUPAC name is 4-(5-ethyl-2-naphthalen-2-yl-1,3-thiazol-4-yl)-2,2,6,6-tetramethyloxane-3,5-dione.
| Compound Name | 4-(5-ethyl-2-naphthalen-2-yl-1,3-thiazol-4-yl)-2,2,6,6-tetramethyloxane-3,5-dione |
|---|---|
| PubChem CID | 59562502 |
| Molecular Formula | C24H25NO3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 4-(5-ethyl-2-naphthalen-2-yl-1,3-thiazol-4-yl)-2,2,6,6-tetramethyloxane-3,5-dione |
| SMILES | CCc1sc(-c2ccc3ccccc3c2)nc1C1C(=O)C(C)(C)OC(C)(C)C1=O |
| InChI | InChI=1S/C24H25NO3S/c1-6-17-19(18-20(26)23(2,3)28-24(4,5)21(18)27)25-22(29-17)16-12-11-14-9-7-8-10-15(14)13-16/h7-13,18H,6H2,1-5H3 |
| InChIKey | KYWKRRWBNAECLT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|