About (4-bromo-2,6-diethylphenyl)boronic acid
(4-bromo-2,6-diethylphenyl)boronic acid (PubChem CID 59562663) has the molecular formula C10H14BBrO2
and a molecular weight of 256.94 g/mol. Its IUPAC name is (4-bromo-2,6-diethylphenyl)boronic acid.
Molecular Properties
| Compound Name | (4-bromo-2,6-diethylphenyl)boronic acid |
| PubChem CID | 59562663 |
| Molecular Formula | C10H14BBrO2 |
| Molecular Weight | 256.94 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | (4-bromo-2,6-diethylphenyl)boronic acid |
| SMILES | CCc1cc(Br)cc(CC)c1B(O)O |
| InChI | InChI=1S/C10H14BBrO2/c1-3-7-5-9(12)6-8(4-2)10(7)11(13)14/h5-6,13-14H,3-4H2,1-2H3 |
| InChIKey | KHXZGRYSDWFUSS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.94 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-2,6-diethylphenyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2,6-diethylphenyl)boronic acid?
The IUPAC name of (4-bromo-2,6-diethylphenyl)boronic acid (CID 59562663) is (4-bromo-2,6-diethylphenyl)boronic acid.
What is the SMILES notation for (4-bromo-2,6-diethylphenyl)boronic acid?
The canonical SMILES for (4-bromo-2,6-diethylphenyl)boronic acid is CCc1cc(Br)cc(CC)c1B(O)O.
What is the InChIKey of (4-bromo-2,6-diethylphenyl)boronic acid?
The InChIKey is KHXZGRYSDWFUSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BBrO2/c1-3-7-5-9(12)6-8(4-2)10(7)11(13)14/h5-6,13-14H,3-4H2,1-2H3.
What are the key properties of (4-bromo-2,6-diethylphenyl)boronic acid?
(4-bromo-2,6-diethylphenyl)boronic acid has a molecular weight of 256.94 g/mol, XLogP of 1.25, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2,6-diethylphenyl)boronic acid is sourced from PubChem (CID 59562663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).