About 1-amino-4-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylic acid
1-amino-4-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylic acid (PubChem CID 59562786) has the molecular formula C9H14F3NO3
and a molecular weight of 241.21 g/mol. Its IUPAC name is 1-amino-4-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylic acid.
Analyze 1-amino-4-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-4-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylic acid?
The IUPAC name of 1-amino-4-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylic acid (CID 59562786) is 1-amino-4-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-amino-4-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylic acid?
The canonical SMILES for 1-amino-4-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylic acid is NC1(C(=O)O)CCC(OCC(F)(F)F)CC1.
What is the InChIKey of 1-amino-4-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylic acid?
The InChIKey is RDVPSKCYYKEYFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3NO3/c10-9(11,12)5-16-6-1-3-8(13,4-2-6)7(14)15/h6H,1-5,13H2,(H,14,15).
What are the key properties of 1-amino-4-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylic acid?
1-amino-4-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylic acid has a molecular weight of 241.21 g/mol, XLogP of 1.29, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-4-(2,2,2-trifluoroethoxy)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 59562786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).