About 3,5,7-trimethyloctanenitrile
3,5,7-trimethyloctanenitrile (PubChem CID 59562796) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is 3,5,7-trimethyloctanenitrile.
Molecular Properties
| Compound Name | 3,5,7-trimethyloctanenitrile |
| PubChem CID | 59562796 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 3,5,7-trimethyloctanenitrile |
| SMILES | CC(C)CC(C)CC(C)CC#N |
| InChI | InChI=1S/C11H21N/c1-9(2)7-11(4)8-10(3)5-6-12/h9-11H,5,7-8H2,1-4H3 |
| InChIKey | OTDFVGUYPKJZGN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5,7-trimethyloctanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5,7-trimethyloctanenitrile?
The IUPAC name of 3,5,7-trimethyloctanenitrile (CID 59562796) is 3,5,7-trimethyloctanenitrile.
What is the SMILES notation for 3,5,7-trimethyloctanenitrile?
The canonical SMILES for 3,5,7-trimethyloctanenitrile is CC(C)CC(C)CC(C)CC#N.
What is the InChIKey of 3,5,7-trimethyloctanenitrile?
The InChIKey is OTDFVGUYPKJZGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N/c1-9(2)7-11(4)8-10(3)5-6-12/h9-11H,5,7-8H2,1-4H3.
What are the key properties of 3,5,7-trimethyloctanenitrile?
3,5,7-trimethyloctanenitrile has a molecular weight of 167.30 g/mol, XLogP of 3.61, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5,7-trimethyloctanenitrile is sourced from PubChem (CID 59562796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).