C26H24F3NO3 — CID 59562870
methyl 4-methoxy-3-[5,5,5-trifluoro-4-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-1-ynyl]benzoate (PubChem CID 59562870) has the molecular formula C26H24F3NO3 and a molecular weight of 455.48 g/mol. Its IUPAC name is methyl 4-methoxy-3-[5,5,5-trifluoro-4-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-1-ynyl]benzoate.
| Compound Name | methyl 4-methoxy-3-[5,5,5-trifluoro-4-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-1-ynyl]benzoate |
|---|---|
| PubChem CID | 59562870 |
| Molecular Formula | C26H24F3NO3 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | methyl 4-methoxy-3-[5,5,5-trifluoro-4-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-1-ynyl]benzoate |
| SMILES | COC(=O)c1ccc(OC)c(C#CCC(N[C@H](C)c2cccc3ccccc23)C(F)(F)F)c1 |
| InChI | InChI=1S/C26H24F3NO3/c1-17(21-12-6-9-18-8-4-5-11-22(18)21)30-24(26(27,28)29)13-7-10-19-16-20(25(31)33-3)14-15-23(19)32-2/h4-6,8-9,11-12,14-17,24,30H,13H2,1-3H3/t17-,24?/m1/s1 |
| InChIKey | NNBWVNIQHCTCDZ-BPNWFJGMSA-N |
| XLogP | 5.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|