C27H30FNO7 — CID 59563050
[(2R,3R,4S,5R)-3-benzoyloxy-4-fluoro-5-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]oxolan-2-yl]methyl benzoate (PubChem CID 59563050) has the molecular formula C27H30FNO7 and a molecular weight of 499.54 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3-benzoyloxy-4-fluoro-5-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R)-3-benzoyloxy-4-fluoro-5-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 59563050 |
| Molecular Formula | C27H30FNO7 |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | [(2R,3R,4S,5R)-3-benzoyloxy-4-fluoro-5-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]oxolan-2-yl]methyl benzoate |
| SMILES | C=CCN(C(=O)OC(C)(C)C)[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1F |
| InChI | InChI=1S/C27H30FNO7/c1-5-16-29(26(32)36-27(2,3)4)23-21(28)22(35-25(31)19-14-10-7-11-15-19)20(34-23)17-33-24(30)18-12-8-6-9-13-18/h5-15,20-23H,1,16-17H2,2-4H3/t20-,21+,22-,23-/m1/s1 |
| InChIKey | AFEAIEWQFQBMAE-KAOXLYBCSA-N |
| XLogP | 4.56 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|