About 4,5-dibromo-N-(3,3-dihydroxypropyl)-1H-pyrrole-2-carboxamide
4,5-dibromo-N-(3,3-dihydroxypropyl)-1H-pyrrole-2-carboxamide (PubChem CID 59563535) has the molecular formula C8H10Br2N2O3
and a molecular weight of 341.99 g/mol. Its IUPAC name is 4,5-dibromo-N-(3,3-dihydroxypropyl)-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4,5-dibromo-N-(3,3-dihydroxypropyl)-1H-pyrrole-2-carboxamide |
| PubChem CID | 59563535 |
| Molecular Formula | C8H10Br2N2O3 |
| Molecular Weight | 341.99 g/mol |
| Exact Mass | 339.91 |
| IUPAC Name | 4,5-dibromo-N-(3,3-dihydroxypropyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCCC(O)O)c1cc(Br)c(Br)[nH]1 |
| InChI | InChI=1S/C8H10Br2N2O3/c9-4-3-5(12-7(4)10)8(15)11-2-1-6(13)14/h3,6,12-14H,1-2H2,(H,11,15) |
| InChIKey | WSLZRKIUIJDEIX-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.99 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dibromo-N-(3,3-dihydroxypropyl)-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dibromo-N-(3,3-dihydroxypropyl)-1H-pyrrole-2-carboxamide?
The IUPAC name of 4,5-dibromo-N-(3,3-dihydroxypropyl)-1H-pyrrole-2-carboxamide (CID 59563535) is 4,5-dibromo-N-(3,3-dihydroxypropyl)-1H-pyrrole-2-carboxamide.
What is the SMILES notation for 4,5-dibromo-N-(3,3-dihydroxypropyl)-1H-pyrrole-2-carboxamide?
The canonical SMILES for 4,5-dibromo-N-(3,3-dihydroxypropyl)-1H-pyrrole-2-carboxamide is O=C(NCCC(O)O)c1cc(Br)c(Br)[nH]1.
What is the InChIKey of 4,5-dibromo-N-(3,3-dihydroxypropyl)-1H-pyrrole-2-carboxamide?
The InChIKey is WSLZRKIUIJDEIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10Br2N2O3/c9-4-3-5(12-7(4)10)8(15)11-2-1-6(13)14/h3,6,12-14H,1-2H2,(H,11,15).
What are the key properties of 4,5-dibromo-N-(3,3-dihydroxypropyl)-1H-pyrrole-2-carboxamide?
4,5-dibromo-N-(3,3-dihydroxypropyl)-1H-pyrrole-2-carboxamide has a molecular weight of 341.99 g/mol, XLogP of 0.97, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dibromo-N-(3,3-dihydroxypropyl)-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 59563535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).