C19H19N3O2 — CID 59563782
3-Amino-2-(4-(hydroxymethyl)phenyl)-N-(isoquinolin-6-yl)propanamide (PubChem CID 59563782) has the molecular formula C19H19N3O2 and a molecular weight of 321.40 g/mol. Its IUPAC name is 3-amino-2-[4-(hydroxymethyl)phenyl]-N-isoquinolin-6-ylpropanamide.
| Compound Name | 3-Amino-2-(4-(hydroxymethyl)phenyl)-N-(isoquinolin-6-yl)propanamide |
|---|---|
| PubChem CID | 59563782 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 3-amino-2-[4-(hydroxymethyl)phenyl]-N-isoquinolin-6-ylpropanamide |
| SMILES | C1=CC(=CC=C1CO)C(CN)C(=O)NC2=CC3=C(C=C2)C=NC=C3 |
| InChI | InChI=1S/C19H19N3O2/c20-10-18(14-3-1-13(12-23)2-4-14)19(24)22-17-6-5-16-11-21-8-7-15(16)9-17/h1-9,11,18,23H,10,12,20H2,(H,22,24) |
| InChIKey | LTXBFJFJUIJOQE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | 409 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |