C12H15ClO2 — CID 59564028
6-chloro-7-propan-2-yloxy-3,4-dihydro-2H-chromene (PubChem CID 59564028) has the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. Its IUPAC name is 6-chloro-7-propan-2-yloxy-3,4-dihydro-2H-chromene.
| Compound Name | 6-chloro-7-propan-2-yloxy-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 59564028 |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 6-chloro-7-propan-2-yloxy-3,4-dihydro-2H-chromene |
| SMILES | CC(C)Oc1cc2c(cc1Cl)CCCO2 |
| InChI | InChI=1S/C12H15ClO2/c1-8(2)15-12-7-11-9(6-10(12)13)4-3-5-14-11/h6-8H,3-5H2,1-2H3 |
| InChIKey | HNYQNHAIDYHREA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.70 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |