About methyl-(2-oxospiro[1H-indole-3,3'-piperidine]-1'-yl)borinic acid
methyl-(2-oxospiro[1H-indole-3,3'-piperidine]-1'-yl)borinic acid (PubChem CID 59564965) has the molecular formula C13H17BN2O2
and a molecular weight of 244.10 g/mol. Its IUPAC name is methyl-(2-oxospiro[1H-indole-3,3'-piperidine]-1'-yl)borinic acid.
Molecular Properties
| Compound Name | methyl-(2-oxospiro[1H-indole-3,3'-piperidine]-1'-yl)borinic acid |
| PubChem CID | 59564965 |
| Molecular Formula | C13H17BN2O2 |
| Molecular Weight | 244.10 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | methyl-(2-oxospiro[1H-indole-3,3'-piperidine]-1'-yl)borinic acid |
| SMILES | CB(O)N1CCCC2(C1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C13H17BN2O2/c1-14(18)16-8-4-7-13(9-16)10-5-2-3-6-11(10)15-12(13)17/h2-3,5-6,18H,4,7-9H2,1H3,(H,15,17) |
| InChIKey | OVVIQCFYGDWQJN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.10 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl-(2-oxospiro[1H-indole-3,3'-piperidine]-1'-yl)borinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-(2-oxospiro[1H-indole-3,3'-piperidine]-1'-yl)borinic acid?
The IUPAC name of methyl-(2-oxospiro[1H-indole-3,3'-piperidine]-1'-yl)borinic acid (CID 59564965) is methyl-(2-oxospiro[1H-indole-3,3'-piperidine]-1'-yl)borinic acid.
What is the SMILES notation for methyl-(2-oxospiro[1H-indole-3,3'-piperidine]-1'-yl)borinic acid?
The canonical SMILES for methyl-(2-oxospiro[1H-indole-3,3'-piperidine]-1'-yl)borinic acid is CB(O)N1CCCC2(C1)C(=O)Nc1ccccc12.
What is the InChIKey of methyl-(2-oxospiro[1H-indole-3,3'-piperidine]-1'-yl)borinic acid?
The InChIKey is OVVIQCFYGDWQJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BN2O2/c1-14(18)16-8-4-7-13(9-16)10-5-2-3-6-11(10)15-12(13)17/h2-3,5-6,18H,4,7-9H2,1H3,(H,15,17).
What are the key properties of methyl-(2-oxospiro[1H-indole-3,3'-piperidine]-1'-yl)borinic acid?
methyl-(2-oxospiro[1H-indole-3,3'-piperidine]-1'-yl)borinic acid has a molecular weight of 244.10 g/mol, XLogP of 1.08, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(2-oxospiro[1H-indole-3,3'-piperidine]-1'-yl)borinic acid is sourced from PubChem (CID 59564965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).