About 4-(1-oxa-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)benzonitrile
4-(1-oxa-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)benzonitrile (PubChem CID 59565037) has the molecular formula C14H17N3O3S
and a molecular weight of 307.38 g/mol. Its IUPAC name is 4-(1-oxa-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)benzonitrile.
Molecular Properties
| Compound Name | 4-(1-oxa-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)benzonitrile |
| PubChem CID | 59565037 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 4-(1-oxa-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)benzonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCC3(CC2)NCCO3)cc1 |
| InChI | InChI=1S/C14H17N3O3S/c15-11-12-1-3-13(4-2-12)21(18,19)17-8-5-14(6-9-17)16-7-10-20-14/h1-4,16H,5-10H2 |
| InChIKey | JXWSBIKXWXADBA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1-oxa-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-oxa-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)benzonitrile?
The IUPAC name of 4-(1-oxa-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)benzonitrile (CID 59565037) is 4-(1-oxa-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)benzonitrile.
What is the SMILES notation for 4-(1-oxa-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)benzonitrile?
The canonical SMILES for 4-(1-oxa-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)benzonitrile is N#Cc1ccc(S(=O)(=O)N2CCC3(CC2)NCCO3)cc1.
What is the InChIKey of 4-(1-oxa-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)benzonitrile?
The InChIKey is JXWSBIKXWXADBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3S/c15-11-12-1-3-13(4-2-12)21(18,19)17-8-5-14(6-9-17)16-7-10-20-14/h1-4,16H,5-10H2.
What are the key properties of 4-(1-oxa-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)benzonitrile?
4-(1-oxa-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)benzonitrile has a molecular weight of 307.38 g/mol, XLogP of 0.66, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-oxa-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)benzonitrile is sourced from PubChem (CID 59565037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).