About 8-(4-butylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decane
8-(4-butylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decane (PubChem CID 59565052) has the molecular formula C17H26N2O3S
and a molecular weight of 338.47 g/mol. Its IUPAC name is 8-(4-butylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-(4-butylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decane |
| PubChem CID | 59565052 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 8-(4-butylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decane |
| SMILES | CCCCc1ccc(S(=O)(=O)N2CCC3(CC2)NCCO3)cc1 |
| InChI | InChI=1S/C17H26N2O3S/c1-2-3-4-15-5-7-16(8-6-15)23(20,21)19-12-9-17(10-13-19)18-11-14-22-17/h5-8,18H,2-4,9-14H2,1H3 |
| InChIKey | LIDUTJLMFRPGBF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-(4-butylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-butylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decane?
The IUPAC name of 8-(4-butylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decane (CID 59565052) is 8-(4-butylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decane.
What is the SMILES notation for 8-(4-butylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decane?
The canonical SMILES for 8-(4-butylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decane is CCCCc1ccc(S(=O)(=O)N2CCC3(CC2)NCCO3)cc1.
What is the InChIKey of 8-(4-butylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decane?
The InChIKey is LIDUTJLMFRPGBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O3S/c1-2-3-4-15-5-7-16(8-6-15)23(20,21)19-12-9-17(10-13-19)18-11-14-22-17/h5-8,18H,2-4,9-14H2,1H3.
What are the key properties of 8-(4-butylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decane?
8-(4-butylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decane has a molecular weight of 338.47 g/mol, XLogP of 2.13, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-butylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decane is sourced from PubChem (CID 59565052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).