About 1-methylsulfanyl-1-(3,7,8-trimethylquinolin-6-yl)oxypropan-2-one
1-methylsulfanyl-1-(3,7,8-trimethylquinolin-6-yl)oxypropan-2-one (PubChem CID 59565290) has the molecular formula C16H19NO2S
and a molecular weight of 289.40 g/mol. Its IUPAC name is 1-methylsulfanyl-1-(3,7,8-trimethylquinolin-6-yl)oxypropan-2-one.
Molecular Properties
| Compound Name | 1-methylsulfanyl-1-(3,7,8-trimethylquinolin-6-yl)oxypropan-2-one |
| PubChem CID | 59565290 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 1-methylsulfanyl-1-(3,7,8-trimethylquinolin-6-yl)oxypropan-2-one |
| SMILES | CSC(Oc1cc2cc(C)cnc2c(C)c1C)C(C)=O |
| InChI | InChI=1S/C16H19NO2S/c1-9-6-13-7-14(19-16(20-5)12(4)18)10(2)11(3)15(13)17-8-9/h6-8,16H,1-5H3 |
| InChIKey | YWKLTXGUUYEESW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methylsulfanyl-1-(3,7,8-trimethylquinolin-6-yl)oxypropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylsulfanyl-1-(3,7,8-trimethylquinolin-6-yl)oxypropan-2-one?
The IUPAC name of 1-methylsulfanyl-1-(3,7,8-trimethylquinolin-6-yl)oxypropan-2-one (CID 59565290) is 1-methylsulfanyl-1-(3,7,8-trimethylquinolin-6-yl)oxypropan-2-one.
What is the SMILES notation for 1-methylsulfanyl-1-(3,7,8-trimethylquinolin-6-yl)oxypropan-2-one?
The canonical SMILES for 1-methylsulfanyl-1-(3,7,8-trimethylquinolin-6-yl)oxypropan-2-one is CSC(Oc1cc2cc(C)cnc2c(C)c1C)C(C)=O.
What is the InChIKey of 1-methylsulfanyl-1-(3,7,8-trimethylquinolin-6-yl)oxypropan-2-one?
The InChIKey is YWKLTXGUUYEESW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2S/c1-9-6-13-7-14(19-16(20-5)12(4)18)10(2)11(3)15(13)17-8-9/h6-8,16H,1-5H3.
What are the key properties of 1-methylsulfanyl-1-(3,7,8-trimethylquinolin-6-yl)oxypropan-2-one?
1-methylsulfanyl-1-(3,7,8-trimethylquinolin-6-yl)oxypropan-2-one has a molecular weight of 289.40 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylsulfanyl-1-(3,7,8-trimethylquinolin-6-yl)oxypropan-2-one is sourced from PubChem (CID 59565290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).