C36H35N3O8P2 — CID 59565892
1,3-bis[2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)ethyl]-5-(2-propoxyethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 59565892) has the molecular formula C36H35N3O8P2 and a molecular weight of 699.64 g/mol. Its IUPAC name is 1,3-bis[2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)ethyl]-5-(2-propoxyethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis[2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)ethyl]-5-(2-propoxyethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 59565892 |
| Molecular Formula | C36H35N3O8P2 |
| Molecular Weight | 699.64 g/mol |
| Exact Mass | 699.19 |
| IUPAC Name | 1,3-bis[2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)ethyl]-5-(2-propoxyethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCCOCCn1c(=O)n(CCP2(=O)Oc3ccccc3-c3ccccc32)c(=O)n(CCP2(=O)Oc3ccccc3-c3ccccc32)c1=O |
| InChI | InChI=1S/C36H35N3O8P2/c1-2-22-45-23-19-37-34(40)38(20-24-48(43)32-17-9-5-13-28(32)26-11-3-7-15-30(26)46-48)36(42)39(35(37)41)21-25-49(44)33-18-10-6-14-29(33)27-12-4-8-16-31(27)47-49/h3-18H,2,19-25H2,1H3 |
| InChIKey | FJOLRRCQBQLKLM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 127.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|