About 4,4-dimethyl-2-methylidene-3H-1,3-benzoselenazine
4,4-dimethyl-2-methylidene-3H-1,3-benzoselenazine (PubChem CID 59565978) has the molecular formula C11H13NSe
and a molecular weight of 238.19 g/mol. Its IUPAC name is 4,4-dimethyl-2-methylidene-3H-1,3-benzoselenazine.
Molecular Properties
| Compound Name | 4,4-dimethyl-2-methylidene-3H-1,3-benzoselenazine |
| PubChem CID | 59565978 |
| Molecular Formula | C11H13NSe |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 4,4-dimethyl-2-methylidene-3H-1,3-benzoselenazine |
| SMILES | C=C1NC(C)(C)c2ccccc2[Se]1 |
| InChI | InChI=1S/C11H13NSe/c1-8-12-11(2,3)9-6-4-5-7-10(9)13-8/h4-7,12H,1H2,2-3H3 |
| InChIKey | LTQYPGAJIYCIDM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethyl-2-methylidene-3H-1,3-benzoselenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-2-methylidene-3H-1,3-benzoselenazine?
The IUPAC name of 4,4-dimethyl-2-methylidene-3H-1,3-benzoselenazine (CID 59565978) is 4,4-dimethyl-2-methylidene-3H-1,3-benzoselenazine.
What is the SMILES notation for 4,4-dimethyl-2-methylidene-3H-1,3-benzoselenazine?
The canonical SMILES for 4,4-dimethyl-2-methylidene-3H-1,3-benzoselenazine is C=C1NC(C)(C)c2ccccc2[Se]1.
What is the InChIKey of 4,4-dimethyl-2-methylidene-3H-1,3-benzoselenazine?
The InChIKey is LTQYPGAJIYCIDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NSe/c1-8-12-11(2,3)9-6-4-5-7-10(9)13-8/h4-7,12H,1H2,2-3H3.
What are the key properties of 4,4-dimethyl-2-methylidene-3H-1,3-benzoselenazine?
4,4-dimethyl-2-methylidene-3H-1,3-benzoselenazine has a molecular weight of 238.19 g/mol, XLogP of 1.33, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-2-methylidene-3H-1,3-benzoselenazine is sourced from PubChem (CID 59565978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).