C19H24F3NO5 — CID 59566038
4-[(3R,5S)-4-[(2-methylpropan-2-yl)oxycarbonyl]-5-(3,4,5-trifluorophenyl)morpholin-3-yl]butanoic acid (PubChem CID 59566038) has the molecular formula C19H24F3NO5 and a molecular weight of 403.40 g/mol. Its IUPAC name is 4-[(3R,5S)-4-[(2-methylpropan-2-yl)oxycarbonyl]-5-(3,4,5-trifluorophenyl)morpholin-3-yl]butanoic acid.
| Compound Name | 4-[(3R,5S)-4-[(2-methylpropan-2-yl)oxycarbonyl]-5-(3,4,5-trifluorophenyl)morpholin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 59566038 |
| Molecular Formula | C19H24F3NO5 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 4-[(3R,5S)-4-[(2-methylpropan-2-yl)oxycarbonyl]-5-(3,4,5-trifluorophenyl)morpholin-3-yl]butanoic acid |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CCCC(=O)O)COC[C@@H]1c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C19H24F3NO5/c1-19(2,3)28-18(26)23-12(5-4-6-16(24)25)9-27-10-15(23)11-7-13(20)17(22)14(21)8-11/h7-8,12,15H,4-6,9-10H2,1-3H3,(H,24,25)/t12-,15-/m1/s1 |
| InChIKey | RLWOPTWTORJREY-IUODEOHRSA-N |
| XLogP | 4.04 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|